C21H18ClNO4S — CID 130222755
[2-chloro-3-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 5-phenylpentanoate (PubChem CID 130222755) has the molecular formula C21H18ClNO4S and a molecular weight of 415.90 g/mol. Its IUPAC name is [2-chloro-3-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 5-phenylpentanoate.
| Compound Name | [2-chloro-3-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 5-phenylpentanoate |
|---|---|
| PubChem CID | 130222755 |
| Molecular Formula | C21H18ClNO4S |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | [2-chloro-3-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 5-phenylpentanoate |
| SMILES | O=C(CCCCc1ccccc1)Oc1cccc(/C=C2\SC(=O)NC2=O)c1Cl |
| InChI | InChI=1S/C21H18ClNO4S/c22-19-15(13-17-20(25)23-21(26)28-17)10-6-11-16(19)27-18(24)12-5-4-9-14-7-2-1-3-8-14/h1-3,6-8,10-11,13H,4-5,9,12H2,(H,23,25,26)/b17-13- |
| InChIKey | SFHSWSPVJSYTPS-LGMDPLHJSA-N |
| XLogP | 4.98 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|