C20H23NO4 — CID 143796696
3-[[5-(3-formyl-2-methylphenyl)-4,6-dimethyl-2-pyridinyl]oxy]propyl acetate (PubChem CID 143796696) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is 3-[[5-(3-formyl-2-methylphenyl)-4,6-dimethyl-2-pyridinyl]oxy]propyl acetate.
| Compound Name | 3-[[5-(3-formyl-2-methylphenyl)-4,6-dimethyl-2-pyridinyl]oxy]propyl acetate |
|---|---|
| PubChem CID | 143796696 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 3-[[5-(3-formyl-2-methylphenyl)-4,6-dimethyl-2-pyridinyl]oxy]propyl acetate |
| SMILES | CC(=O)OCCCOc1cc(C)c(-c2cccc(C=O)c2C)c(C)n1 |
| InChI | InChI=1S/C20H23NO4/c1-13-11-19(25-10-6-9-24-16(4)23)21-15(3)20(13)18-8-5-7-17(12-22)14(18)2/h5,7-8,11-12H,6,9-10H2,1-4H3 |
| InChIKey | PSRFMBWVJDEUCY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|