C24H31NO4 — CID 58082958
tert-butyl N-[3-[4-(3-formyl-2-methylphenyl)-3,5-dimethylphenoxy]propyl]carbamate (PubChem CID 58082958) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is tert-butyl N-[3-[4-(3-formyl-2-methylphenyl)-3,5-dimethylphenoxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-(3-formyl-2-methylphenyl)-3,5-dimethylphenoxy]propyl]carbamate |
|---|---|
| PubChem CID | 58082958 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | tert-butyl N-[3-[4-(3-formyl-2-methylphenyl)-3,5-dimethylphenoxy]propyl]carbamate |
| SMILES | Cc1cc(OCCCNC(=O)OC(C)(C)C)cc(C)c1-c1cccc(C=O)c1C |
| InChI | InChI=1S/C24H31NO4/c1-16-13-20(28-12-8-11-25-23(27)29-24(4,5)6)14-17(2)22(16)21-10-7-9-19(15-26)18(21)3/h7,9-10,13-15H,8,11-12H2,1-6H3,(H,25,27) |
| InChIKey | DMBVJYJXEHACMY-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|