C31H37NO5 — CID 141233655
tert-butyl N-[3-[4-[3-[(4-formylphenoxy)methyl]-2,6-dimethylphenyl]-3-methylphenoxy]propyl]carbamate (PubChem CID 141233655) has the molecular formula C31H37NO5 and a molecular weight of 503.64 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[3-[(4-formylphenoxy)methyl]-2,6-dimethylphenyl]-3-methylphenoxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[3-[(4-formylphenoxy)methyl]-2,6-dimethylphenyl]-3-methylphenoxy]propyl]carbamate |
|---|---|
| PubChem CID | 141233655 |
| Molecular Formula | C31H37NO5 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.27 |
| IUPAC Name | tert-butyl N-[3-[4-[3-[(4-formylphenoxy)methyl]-2,6-dimethylphenyl]-3-methylphenoxy]propyl]carbamate |
| SMILES | Cc1cc(OCCCNC(=O)OC(C)(C)C)ccc1-c1c(C)ccc(COc2ccc(C=O)cc2)c1C |
| InChI | InChI=1S/C31H37NO5/c1-21-8-11-25(20-36-26-12-9-24(19-33)10-13-26)23(3)29(21)28-15-14-27(18-22(28)2)35-17-7-16-32-30(34)37-31(4,5)6/h8-15,18-19H,7,16-17,20H2,1-6H3,(H,32,34) |
| InChIKey | IBFRKRXTDSPGRQ-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|