C27H28O5 — CID 91037443
(3S)-4-[4-[3-[(4-formylphenoxy)methyl]-2-methylphenyl]-3-methylphenoxy]-3-methylbutanoic acid (PubChem CID 91037443) has the molecular formula C27H28O5 and a molecular weight of 432.52 g/mol. Its IUPAC name is (3S)-4-[4-[3-[(4-formylphenoxy)methyl]-2-methylphenyl]-3-methylphenoxy]-3-methylbutanoic acid.
| Compound Name | (3S)-4-[4-[3-[(4-formylphenoxy)methyl]-2-methylphenyl]-3-methylphenoxy]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 91037443 |
| Molecular Formula | C27H28O5 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | (3S)-4-[4-[3-[(4-formylphenoxy)methyl]-2-methylphenyl]-3-methylphenoxy]-3-methylbutanoic acid |
| SMILES | Cc1cc(OC[C@@H](C)CC(=O)O)ccc1-c1cccc(COc2ccc(C=O)cc2)c1C |
| InChI | InChI=1S/C27H28O5/c1-18(13-27(29)30)16-31-24-11-12-25(19(2)14-24)26-6-4-5-22(20(26)3)17-32-23-9-7-21(15-28)8-10-23/h4-12,14-15,18H,13,16-17H2,1-3H3,(H,29,30)/t18-/m0/s1 |
| InChIKey | NSYLEFAKKXBSSX-SFHVURJKSA-N |
| XLogP | 5.85 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|