C27H30O5 — CID 89039088
4-[[3-[4-[(2R)-2-hydroxy-3-methoxypropoxy]-2,6-dimethylphenyl]-2-methylphenyl]methoxy]benzaldehyde (PubChem CID 89039088) has the molecular formula C27H30O5 and a molecular weight of 434.53 g/mol. Its IUPAC name is 4-[[3-[4-[(2R)-2-hydroxy-3-methoxypropoxy]-2,6-dimethylphenyl]-2-methylphenyl]methoxy]benzaldehyde.
| Compound Name | 4-[[3-[4-[(2R)-2-hydroxy-3-methoxypropoxy]-2,6-dimethylphenyl]-2-methylphenyl]methoxy]benzaldehyde |
|---|---|
| PubChem CID | 89039088 |
| Molecular Formula | C27H30O5 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 4-[[3-[4-[(2R)-2-hydroxy-3-methoxypropoxy]-2,6-dimethylphenyl]-2-methylphenyl]methoxy]benzaldehyde |
| SMILES | COC[C@@H](O)COc1cc(C)c(-c2cccc(COc3ccc(C=O)cc3)c2C)c(C)c1 |
| InChI | InChI=1S/C27H30O5/c1-18-12-25(32-17-23(29)16-30-4)13-19(2)27(18)26-7-5-6-22(20(26)3)15-31-24-10-8-21(14-28)9-11-24/h5-14,23,29H,15-17H2,1-4H3/t23-/m1/s1 |
| InChIKey | MMDRDSXIMRZDPX-HSZRJFAPSA-N |
| XLogP | 5.06 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|