C21H29NO4SSi — CID 86719045
5-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-6-(4-methylsulfinylphenyl)pyridine-2-carbaldehyde (PubChem CID 86719045) has the molecular formula C21H29NO4SSi and a molecular weight of 419.62 g/mol. Its IUPAC name is 5-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-6-(4-methylsulfinylphenyl)pyridine-2-carbaldehyde.
| Compound Name | 5-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-6-(4-methylsulfinylphenyl)pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 86719045 |
| Molecular Formula | C21H29NO4SSi |
| Molecular Weight | 419.62 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 5-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-6-(4-methylsulfinylphenyl)pyridine-2-carbaldehyde |
| SMILES | CS(=O)c1ccc(-c2nc(C=O)ccc2OCCO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H29NO4SSi/c1-21(2,3)28(5,6)26-14-13-25-19-12-9-17(15-23)22-20(19)16-7-10-18(11-8-16)27(4)24/h7-12,15H,13-14H2,1-6H3 |
| InChIKey | LEDGZWIKINYSIF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.62 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|