C26H40O3Si — CID 102173957
tert-butyl-[6-(methoxymethoxy)-6-methylheptoxy]-diphenylsilane (PubChem CID 102173957) has the molecular formula C26H40O3Si and a molecular weight of 428.69 g/mol. Its IUPAC name is tert-butyl-[6-(methoxymethoxy)-6-methylheptoxy]-diphenylsilane.
| Compound Name | tert-butyl-[6-(methoxymethoxy)-6-methylheptoxy]-diphenylsilane |
|---|---|
| PubChem CID | 102173957 |
| Molecular Formula | C26H40O3Si |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | tert-butyl-[6-(methoxymethoxy)-6-methylheptoxy]-diphenylsilane |
| SMILES | COCOC(C)(C)CCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H40O3Si/c1-25(2,3)30(23-16-10-7-11-17-23,24-18-12-8-13-19-24)29-21-15-9-14-20-26(4,5)28-22-27-6/h7-8,10-13,16-19H,9,14-15,20-22H2,1-6H3 |
| InChIKey | ITUVOAVJXHYGLL-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|