C34H41O2PSi — CID 11953688
[5-[tert-butyl(diphenyl)silyl]oxy-2-methylpentan-2-yl]oxy-diphenylphosphane (PubChem CID 11953688) has the molecular formula C34H41O2PSi and a molecular weight of 540.76 g/mol. Its IUPAC name is [5-[tert-butyl(diphenyl)silyl]oxy-2-methylpentan-2-yl]oxy-diphenylphosphane.
| Compound Name | [5-[tert-butyl(diphenyl)silyl]oxy-2-methylpentan-2-yl]oxy-diphenylphosphane |
|---|---|
| PubChem CID | 11953688 |
| Molecular Formula | C34H41O2PSi |
| Molecular Weight | 540.76 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | [5-[tert-butyl(diphenyl)silyl]oxy-2-methylpentan-2-yl]oxy-diphenylphosphane |
| SMILES | CC(C)(CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H41O2PSi/c1-33(2,3)38(31-23-14-8-15-24-31,32-25-16-9-17-26-32)35-28-18-27-34(4,5)36-37(29-19-10-6-11-20-29)30-21-12-7-13-22-30/h6-17,19-26H,18,27-28H2,1-5H3 |
| InChIKey | RNFVLJKGNSRDPG-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.76 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|