C29H34O4Si — CID 132916777
6-[8-[tert-butyl(diphenyl)silyl]oxyoct-5-ynyl]-4-hydroxypyran-2-one (PubChem CID 132916777) has the molecular formula C29H34O4Si and a molecular weight of 474.67 g/mol. Its IUPAC name is 6-[8-[tert-butyl(diphenyl)silyl]oxyoct-5-ynyl]-4-hydroxypyran-2-one.
| Compound Name | 6-[8-[tert-butyl(diphenyl)silyl]oxyoct-5-ynyl]-4-hydroxypyran-2-one |
|---|---|
| PubChem CID | 132916777 |
| Molecular Formula | C29H34O4Si |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | 6-[8-[tert-butyl(diphenyl)silyl]oxyoct-5-ynyl]-4-hydroxypyran-2-one |
| SMILES | CC(C)(C)[Si](OCCC#CCCCCc1cc(O)cc(=O)o1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H34O4Si/c1-29(2,3)34(26-17-11-8-12-18-26,27-19-13-9-14-20-27)32-21-15-7-5-4-6-10-16-25-22-24(30)23-28(31)33-25/h8-9,11-14,17-20,22-23,30H,4,6,10,15-16,21H2,1-3H3 |
| InChIKey | WOAIGZPFENNVBZ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|