C27H28ClNO2Si — CID 153467896
6-[tert-butyl(diphenyl)silyl]oxy-1-(2-chloro-3-pyridinyl)hex-2-yn-1-one (PubChem CID 153467896) has the molecular formula C27H28ClNO2Si and a molecular weight of 462.07 g/mol. Its IUPAC name is 6-[tert-butyl(diphenyl)silyl]oxy-1-(2-chloro-3-pyridinyl)hex-2-yn-1-one.
| Compound Name | 6-[tert-butyl(diphenyl)silyl]oxy-1-(2-chloro-3-pyridinyl)hex-2-yn-1-one |
|---|---|
| PubChem CID | 153467896 |
| Molecular Formula | C27H28ClNO2Si |
| Molecular Weight | 462.07 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 6-[tert-butyl(diphenyl)silyl]oxy-1-(2-chloro-3-pyridinyl)hex-2-yn-1-one |
| SMILES | CC(C)(C)[Si](OCCCC#CC(=O)c1cccnc1Cl)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H28ClNO2Si/c1-27(2,3)32(22-14-7-4-8-15-22,23-16-9-5-10-17-23)31-21-12-6-11-19-25(30)24-18-13-20-29-26(24)28/h4-5,7-10,13-18,20H,6,12,21H2,1-3H3 |
| InChIKey | FHXTXVXNRZYTQE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.07 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|