C25H32O4Si — CID 24795140
7-[tert-butyl(diphenyl)silyl]oxy-1,1-dimethoxyhept-4-yn-3-one (PubChem CID 24795140) has the molecular formula C25H32O4Si and a molecular weight of 424.61 g/mol. Its IUPAC name is 7-[tert-butyl(diphenyl)silyl]oxy-1,1-dimethoxyhept-4-yn-3-one.
| Compound Name | 7-[tert-butyl(diphenyl)silyl]oxy-1,1-dimethoxyhept-4-yn-3-one |
|---|---|
| PubChem CID | 24795140 |
| Molecular Formula | C25H32O4Si |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 7-[tert-butyl(diphenyl)silyl]oxy-1,1-dimethoxyhept-4-yn-3-one |
| SMILES | COC(CC(=O)C#CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC |
| InChI | InChI=1S/C25H32O4Si/c1-25(2,3)30(22-15-8-6-9-16-22,23-17-10-7-11-18-23)29-19-13-12-14-21(26)20-24(27-4)28-5/h6-11,15-18,24H,13,19-20H2,1-5H3 |
| InChIKey | NPLPVBXXBMUCLJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|