C21H30N2O5 — CID 19596637
tert-butyl N-[2-[[4-(1-hydroxy-3-methylbutyl)-5-phenyl-1,2-oxazol-3-yl]oxy]ethyl]carbamate (PubChem CID 19596637) has the molecular formula C21H30N2O5 and a molecular weight of 390.48 g/mol. Its IUPAC name is tert-butyl N-[2-[[4-(1-hydroxy-3-methylbutyl)-5-phenyl-1,2-oxazol-3-yl]oxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[4-(1-hydroxy-3-methylbutyl)-5-phenyl-1,2-oxazol-3-yl]oxy]ethyl]carbamate |
|---|---|
| PubChem CID | 19596637 |
| Molecular Formula | C21H30N2O5 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | tert-butyl N-[2-[[4-(1-hydroxy-3-methylbutyl)-5-phenyl-1,2-oxazol-3-yl]oxy]ethyl]carbamate |
| SMILES | CC(C)CC(O)c1c(OCCNC(=O)OC(C)(C)C)noc1-c1ccccc1 |
| InChI | InChI=1S/C21H30N2O5/c1-14(2)13-16(24)17-18(15-9-7-6-8-10-15)28-23-19(17)26-12-11-22-20(25)27-21(3,4)5/h6-10,14,16,24H,11-13H2,1-5H3,(H,22,25) |
| InChIKey | HSYKLTTUENEVOL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|