C18H23ClN2O4 — CID 19596673
tert-butyl N-[2-[[5-(4-chlorophenyl)-4-ethyl-1,2-oxazol-3-yl]oxy]ethyl]carbamate (PubChem CID 19596673) has the molecular formula C18H23ClN2O4 and a molecular weight of 366.85 g/mol. Its IUPAC name is tert-butyl N-[2-[[5-(4-chlorophenyl)-4-ethyl-1,2-oxazol-3-yl]oxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[5-(4-chlorophenyl)-4-ethyl-1,2-oxazol-3-yl]oxy]ethyl]carbamate |
|---|---|
| PubChem CID | 19596673 |
| Molecular Formula | C18H23ClN2O4 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | tert-butyl N-[2-[[5-(4-chlorophenyl)-4-ethyl-1,2-oxazol-3-yl]oxy]ethyl]carbamate |
| SMILES | CCc1c(OCCNC(=O)OC(C)(C)C)noc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H23ClN2O4/c1-5-14-15(12-6-8-13(19)9-7-12)25-21-16(14)23-11-10-20-17(22)24-18(2,3)4/h6-9H,5,10-11H2,1-4H3,(H,20,22) |
| InChIKey | IWTVYUXXSRCTSG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|