C14H17N3O6 — CID 15453945
tert-butyl N-[2-[(5-nitro-1,2-benzoxazol-3-yl)oxy]ethyl]carbamate (PubChem CID 15453945) has the molecular formula C14H17N3O6 and a molecular weight of 323.31 g/mol. Its IUPAC name is tert-butyl N-[2-[(5-nitro-1,2-benzoxazol-3-yl)oxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(5-nitro-1,2-benzoxazol-3-yl)oxy]ethyl]carbamate |
|---|---|
| PubChem CID | 15453945 |
| Molecular Formula | C14H17N3O6 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | tert-butyl N-[2-[(5-nitro-1,2-benzoxazol-3-yl)oxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOc1noc2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C14H17N3O6/c1-14(2,3)22-13(18)15-6-7-21-12-10-8-9(17(19)20)4-5-11(10)23-16-12/h4-5,8H,6-7H2,1-3H3,(H,15,18) |
| InChIKey | CBYZWVOYIXARLT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|