C15H19BrN2O4 — CID 18696102
tert-butyl N-[2-[(5-bromo-7-methyl-1,2-benzoxazol-3-yl)oxy]ethyl]carbamate (PubChem CID 18696102) has the molecular formula C15H19BrN2O4 and a molecular weight of 371.23 g/mol. Its IUPAC name is tert-butyl N-[2-[(5-bromo-7-methyl-1,2-benzoxazol-3-yl)oxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(5-bromo-7-methyl-1,2-benzoxazol-3-yl)oxy]ethyl]carbamate |
|---|---|
| PubChem CID | 18696102 |
| Molecular Formula | C15H19BrN2O4 |
| Molecular Weight | 371.23 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | tert-butyl N-[2-[(5-bromo-7-methyl-1,2-benzoxazol-3-yl)oxy]ethyl]carbamate |
| SMILES | Cc1cc(Br)cc2c(OCCNC(=O)OC(C)(C)C)noc12 |
| InChI | InChI=1S/C15H19BrN2O4/c1-9-7-10(16)8-11-12(9)22-18-13(11)20-6-5-17-14(19)21-15(2,3)4/h7-8H,5-6H2,1-4H3,(H,17,19) |
| InChIKey | DSCANFOHZNZVMR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.23 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|