C22H29NO5S — CID 141296202
tert-butyl N-[2-[5-(benzenesulfonylmethyl)-2-ethylphenoxy]ethyl]carbamate (PubChem CID 141296202) has the molecular formula C22H29NO5S and a molecular weight of 419.54 g/mol. Its IUPAC name is tert-butyl N-[2-[5-(benzenesulfonylmethyl)-2-ethylphenoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[5-(benzenesulfonylmethyl)-2-ethylphenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 141296202 |
| Molecular Formula | C22H29NO5S |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | tert-butyl N-[2-[5-(benzenesulfonylmethyl)-2-ethylphenoxy]ethyl]carbamate |
| SMILES | CCc1ccc(CS(=O)(=O)c2ccccc2)cc1OCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H29NO5S/c1-5-18-12-11-17(16-29(25,26)19-9-7-6-8-10-19)15-20(18)27-14-13-23-21(24)28-22(2,3)4/h6-12,15H,5,13-14,16H2,1-4H3,(H,23,24) |
| InChIKey | DROFVTASFCEWLE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|