C33H46BrF2NO6S — CID 69040443
2-[2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)-4-[(2R)-2-propyloctanoyl]oxybut-2-enoyl]oxyethyl-trimethylazanium bromide (PubChem CID 69040443) has the molecular formula C33H46BrF2NO6S and a molecular weight of 702.70 g/mol. Its IUPAC name is 2-[2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)-4-[(2R)-2-propyloctanoyl]oxybut-2-enoyl]oxyethyl-trimethylazanium bromide.
| Compound Name | 2-[2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)-4-[(2R)-2-propyloctanoyl]oxybut-2-enoyl]oxyethyl-trimethylazanium bromide |
|---|---|
| PubChem CID | 69040443 |
| Molecular Formula | C33H46BrF2NO6S |
| Molecular Weight | 702.70 g/mol |
| Exact Mass | 701.22 |
| IUPAC Name | 2-[2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)-4-[(2R)-2-propyloctanoyl]oxybut-2-enoyl]oxyethyl-trimethylazanium bromide |
| SMILES | CCCCCC[C@@H](CCC)C(=O)OCC(=C(C(=O)OCC[N+](C)(C)C)c1ccc(F)c(F)c1)c1ccc(S(C)(=O)=O)cc1.[Br-] |
| InChI | InChI=1S/C33H46F2NO6S.BrH/c1-7-9-10-11-13-25(12-8-2)32(37)42-23-28(24-14-17-27(18-15-24)43(6,39)40)31(26-16-19-29(34)30(35)22-26)33(38)41-21-20-36(3,4)5;/h14-19,22,25H,7-13,20-21,23H2,1-6H3;1H/q+1;/p-1/t25-;/m1./s1 |
| InChIKey | CZMSUSNOEJLOAM-VQIWEWKSSA-M |
| XLogP | 3.46 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.70 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|