C15H20F2O2 — CID 43800697
1-(3,4-difluorophenyl)-2-hexoxypropan-1-one (PubChem CID 43800697) has the molecular formula C15H20F2O2 and a molecular weight of 270.32 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-2-hexoxypropan-1-one.
| Compound Name | 1-(3,4-difluorophenyl)-2-hexoxypropan-1-one |
|---|---|
| PubChem CID | 43800697 |
| Molecular Formula | C15H20F2O2 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 1-(3,4-difluorophenyl)-2-hexoxypropan-1-one |
| SMILES | CCCCCCOC(C)C(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H20F2O2/c1-3-4-5-6-9-19-11(2)15(18)12-7-8-13(16)14(17)10-12/h7-8,10-11H,3-6,9H2,1-2H3 |
| InChIKey | ZWXDLQBEOMCKHG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|