C35H28F4O10S2 — CID 157092302
(Z)-2-(3,4-difluorophenyl)-4-[(Z)-2-(3,4-difluorophenyl)-4-(hydroxymethoxy)-3-(4-methylsulfinyloxyphenyl)but-2-enoyl]oxy-3-(4-methoxysulfinylphenyl)but-2-enoic acid (PubChem CID 157092302) has the molecular formula C35H28F4O10S2 and a molecular weight of 748.73 g/mol. Its IUPAC name is (Z)-2-(3,4-difluorophenyl)-4-[(Z)-2-(3,4-difluorophenyl)-4-(hydroxymethoxy)-3-(4-methylsulfinyloxyphenyl)but-2-enoyl]oxy-3-(4-methoxysulfinylphenyl)but-2-enoic acid.
| Compound Name | (Z)-2-(3,4-difluorophenyl)-4-[(Z)-2-(3,4-difluorophenyl)-4-(hydroxymethoxy)-3-(4-methylsulfinyloxyphenyl)but-2-enoyl]oxy-3-(4-methoxysulfinylphenyl)but-2-enoic acid |
|---|---|
| PubChem CID | 157092302 |
| Molecular Formula | C35H28F4O10S2 |
| Molecular Weight | 748.73 g/mol |
| Exact Mass | 748.11 |
| IUPAC Name | (Z)-2-(3,4-difluorophenyl)-4-[(Z)-2-(3,4-difluorophenyl)-4-(hydroxymethoxy)-3-(4-methylsulfinyloxyphenyl)but-2-enoyl]oxy-3-(4-methoxysulfinylphenyl)but-2-enoic acid |
| SMILES | COS(=O)c1ccc(/C(COC(=O)/C(=C(\COCO)c2ccc(OS(C)=O)cc2)c2ccc(F)c(F)c2)=C(/C(=O)O)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C35H28F4O10S2/c1-46-51(45)25-11-5-21(6-12-25)27(32(34(41)42)22-7-13-28(36)30(38)15-22)18-48-35(43)33(23-8-14-29(37)31(39)16-23)26(17-47-19-40)20-3-9-24(10-4-20)49-50(2)44/h3-16,40H,17-19H2,1-2H3,(H,41,42)/b32-27+,33-26+ |
| InChIKey | AEUMOSDJSNBWRZ-KSEKSHHJSA-N |
| XLogP | 5.70 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.73 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|