C15H25N3O8 — CID 77488475
5,6-bis[(dihydroxyamino)oxy]hexyl 2-amino-3-phenylpropanoate (PubChem CID 77488475) has the molecular formula C15H25N3O8 and a molecular weight of 375.38 g/mol. Its IUPAC name is 5,6-bis[(dihydroxyamino)oxy]hexyl 2-amino-3-phenylpropanoate.
| Compound Name | 5,6-bis[(dihydroxyamino)oxy]hexyl 2-amino-3-phenylpropanoate |
|---|---|
| PubChem CID | 77488475 |
| Molecular Formula | C15H25N3O8 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 5,6-bis[(dihydroxyamino)oxy]hexyl 2-amino-3-phenylpropanoate |
| SMILES | NC(Cc1ccccc1)C(=O)OCCCCC(CON(O)O)ON(O)O |
| InChI | InChI=1S/C15H25N3O8/c16-14(10-12-6-2-1-3-7-12)15(19)24-9-5-4-8-13(26-18(22)23)11-25-17(20)21/h1-3,6-7,13-14,20-23H,4-5,8-11,16H2 |
| InChIKey | RPDVMTICOAPTFF-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|