C19H31N3O11 — CID 89081185
1-[5,6-bis[(dihydroxyamino)oxy]hexoxycarbonyloxy]ethyl 2-amino-4-phenylbutanoate (PubChem CID 89081185) has the molecular formula C19H31N3O11 and a molecular weight of 477.47 g/mol. Its IUPAC name is 1-[5,6-bis[(dihydroxyamino)oxy]hexoxycarbonyloxy]ethyl 2-amino-4-phenylbutanoate.
| Compound Name | 1-[5,6-bis[(dihydroxyamino)oxy]hexoxycarbonyloxy]ethyl 2-amino-4-phenylbutanoate |
|---|---|
| PubChem CID | 89081185 |
| Molecular Formula | C19H31N3O11 |
| Molecular Weight | 477.47 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 1-[5,6-bis[(dihydroxyamino)oxy]hexoxycarbonyloxy]ethyl 2-amino-4-phenylbutanoate |
| SMILES | CC(OC(=O)OCCCCC(CON(O)O)ON(O)O)OC(=O)C(N)CCc1ccccc1 |
| InChI | InChI=1S/C19H31N3O11/c1-14(31-18(23)17(20)11-10-15-7-3-2-4-8-15)32-19(24)29-12-6-5-9-16(33-22(27)28)13-30-21(25)26/h2-4,7-8,14,16-17,25-28H,5-6,9-13,20H2,1H3 |
| InChIKey | LCKGLZHHJYZMDW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 193.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.47 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|