About isocyanic acid;octyl (2S)-2-amino-3-phenylpropanoate
isocyanic acid;octyl (2S)-2-amino-3-phenylpropanoate (PubChem CID 89183750) has the molecular formula C18H28N2O3
and a molecular weight of 320.43 g/mol. Its IUPAC name is isocyanic acid;octyl (2S)-2-amino-3-phenylpropanoate.
Molecular Properties
| Compound Name | isocyanic acid;octyl (2S)-2-amino-3-phenylpropanoate |
| PubChem CID | 89183750 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | isocyanic acid;octyl (2S)-2-amino-3-phenylpropanoate |
| SMILES | CCCCCCCCOC(=O)[C@@H](N)Cc1ccccc1.N=C=O |
| InChI | InChI=1S/C17H27NO2.CHNO/c1-2-3-4-5-6-10-13-20-17(19)16(18)14-15-11-8-7-9-12-15;2-1-3/h7-9,11-12,16H,2-6,10,13-14,18H2,1H3;2H/t16-;/m0./s1 |
| InChIKey | KSPHHIVDGBKWLF-NTISSMGPSA-N |
| XLogP | 3.36 |
| TPSA | 93.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze isocyanic acid;octyl (2S)-2-amino-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isocyanic acid;octyl (2S)-2-amino-3-phenylpropanoate?
The IUPAC name of isocyanic acid;octyl (2S)-2-amino-3-phenylpropanoate (CID 89183750) is isocyanic acid;octyl (2S)-2-amino-3-phenylpropanoate.
What is the SMILES notation for isocyanic acid;octyl (2S)-2-amino-3-phenylpropanoate?
The canonical SMILES for isocyanic acid;octyl (2S)-2-amino-3-phenylpropanoate is CCCCCCCCOC(=O)[C@@H](N)Cc1ccccc1.N=C=O.
What is the InChIKey of isocyanic acid;octyl (2S)-2-amino-3-phenylpropanoate?
The InChIKey is KSPHHIVDGBKWLF-NTISSMGPSA-N. The full InChI is InChI=1S/C17H27NO2.CHNO/c1-2-3-4-5-6-10-13-20-17(19)16(18)14-15-11-8-7-9-12-15;2-1-3/h7-9,11-12,16H,2-6,10,13-14,18H2,1H3;2H/t16-;/m0./s1.
What are the key properties of isocyanic acid;octyl (2S)-2-amino-3-phenylpropanoate?
isocyanic acid;octyl (2S)-2-amino-3-phenylpropanoate has a molecular weight of 320.43 g/mol, XLogP of 3.36, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for isocyanic acid;octyl (2S)-2-amino-3-phenylpropanoate is sourced from PubChem (CID 89183750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).