About ethyl 2-amino-3-phenylpropanoate;isocyanic acid
ethyl 2-amino-3-phenylpropanoate;isocyanic acid (PubChem CID 175019136) has the molecular formula C12H16N2O3
and a molecular weight of 236.27 g/mol. Its IUPAC name is ethyl 2-amino-3-phenylpropanoate;isocyanic acid.
Molecular Properties
| Compound Name | ethyl 2-amino-3-phenylpropanoate;isocyanic acid |
| PubChem CID | 175019136 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | ethyl 2-amino-3-phenylpropanoate;isocyanic acid |
| SMILES | CCOC(=O)C(N)Cc1ccccc1.N=C=O |
| InChI | InChI=1S/C11H15NO2.CHNO/c1-2-14-11(13)10(12)8-9-6-4-3-5-7-9;2-1-3/h3-7,10H,2,8,12H2,1H3;2H |
| InChIKey | SXBZIBPQVJYXJS-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 93.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-amino-3-phenylpropanoate;isocyanic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-amino-3-phenylpropanoate;isocyanic acid?
The IUPAC name of ethyl 2-amino-3-phenylpropanoate;isocyanic acid (CID 175019136) is ethyl 2-amino-3-phenylpropanoate;isocyanic acid.
What is the SMILES notation for ethyl 2-amino-3-phenylpropanoate;isocyanic acid?
The canonical SMILES for ethyl 2-amino-3-phenylpropanoate;isocyanic acid is CCOC(=O)C(N)Cc1ccccc1.N=C=O.
What is the InChIKey of ethyl 2-amino-3-phenylpropanoate;isocyanic acid?
The InChIKey is SXBZIBPQVJYXJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2.CHNO/c1-2-14-11(13)10(12)8-9-6-4-3-5-7-9;2-1-3/h3-7,10H,2,8,12H2,1H3;2H.
What are the key properties of ethyl 2-amino-3-phenylpropanoate;isocyanic acid?
ethyl 2-amino-3-phenylpropanoate;isocyanic acid has a molecular weight of 236.27 g/mol, XLogP of 1.02, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-amino-3-phenylpropanoate;isocyanic acid is sourced from PubChem (CID 175019136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).