About 2-(methylamino)ethyl 2-amino-3-methylbutanoate
2-(methylamino)ethyl 2-amino-3-methylbutanoate (PubChem CID 72523693) has the molecular formula C8H18N2O2
and a molecular weight of 174.24 g/mol. Its IUPAC name is 2-(methylamino)ethyl 2-amino-3-methylbutanoate.
Molecular Properties
| Compound Name | 2-(methylamino)ethyl 2-amino-3-methylbutanoate |
| PubChem CID | 72523693 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 2-(methylamino)ethyl 2-amino-3-methylbutanoate |
| SMILES | CNCCOC(=O)C(N)C(C)C |
| InChI | InChI=1S/C8H18N2O2/c1-6(2)7(9)8(11)12-5-4-10-3/h6-7,10H,4-5,9H2,1-3H3 |
| InChIKey | YQKPOSIREUEYEY-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(methylamino)ethyl 2-amino-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methylamino)ethyl 2-amino-3-methylbutanoate?
The IUPAC name of 2-(methylamino)ethyl 2-amino-3-methylbutanoate (CID 72523693) is 2-(methylamino)ethyl 2-amino-3-methylbutanoate.
What is the SMILES notation for 2-(methylamino)ethyl 2-amino-3-methylbutanoate?
The canonical SMILES for 2-(methylamino)ethyl 2-amino-3-methylbutanoate is CNCCOC(=O)C(N)C(C)C.
What is the InChIKey of 2-(methylamino)ethyl 2-amino-3-methylbutanoate?
The InChIKey is YQKPOSIREUEYEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O2/c1-6(2)7(9)8(11)12-5-4-10-3/h6-7,10H,4-5,9H2,1-3H3.
What are the key properties of 2-(methylamino)ethyl 2-amino-3-methylbutanoate?
2-(methylamino)ethyl 2-amino-3-methylbutanoate has a molecular weight of 174.24 g/mol, XLogP of -0.27, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylamino)ethyl 2-amino-3-methylbutanoate is sourced from PubChem (CID 72523693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).