C13H27NO2 — CID 138564197
2-(methylamino)ethyl 2-tert-butyl-3,3-dimethylbutanoate (PubChem CID 138564197) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is 2-(methylamino)ethyl 2-tert-butyl-3,3-dimethylbutanoate.
| Compound Name | 2-(methylamino)ethyl 2-tert-butyl-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 138564197 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 2-(methylamino)ethyl 2-tert-butyl-3,3-dimethylbutanoate |
| SMILES | CNCCOC(=O)C(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H27NO2/c1-12(2,3)10(13(4,5)6)11(15)16-9-8-14-7/h10,14H,8-9H2,1-7H3 |
| InChIKey | HNSMCBGPAAUHND-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|