C16H31N2O4Y- — CID 58481251
bis[2-(methylamino)ethyl] 2,4-dimethyl-2-propylpentanedioate;yttrium (PubChem CID 58481251) has the molecular formula C16H31N2O4Y- and a molecular weight of 404.34 g/mol. Its IUPAC name is bis[2-(methylamino)ethyl] 2,4-dimethyl-2-propylpentanedioate;yttrium.
| Compound Name | bis[2-(methylamino)ethyl] 2,4-dimethyl-2-propylpentanedioate;yttrium |
|---|---|
| PubChem CID | 58481251 |
| Molecular Formula | C16H31N2O4Y- |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | bis[2-(methylamino)ethyl] 2,4-dimethyl-2-propylpentanedioate;yttrium |
| SMILES | [CH2-]CCC(C)(CC(C)C(=O)OCCNC)C(=O)OCCNC.[Y] |
| InChI | InChI=1S/C16H31N2O4.Y/c1-6-7-16(3,15(20)22-11-9-18-5)12-13(2)14(19)21-10-8-17-4;/h13,17-18H,1,6-12H2,2-5H3;/q-1; |
| InChIKey | MRZOJSUOAYFNJB-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|