C34H60N2O8 — CID 172866623
[(3S,3aR,6R,6aR)-6-[(2S)-4-methyl-2-(octanoylamino)pentanoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] (2S)-4-methyl-2-(octanoylamino)pentanoate (PubChem CID 172866623) has the molecular formula C34H60N2O8 and a molecular weight of 624.86 g/mol. Its IUPAC name is [(3S,3aR,6R,6aR)-6-[(2S)-4-methyl-2-(octanoylamino)pentanoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] (2S)-4-methyl-2-(octanoylamino)pentanoate.
| Compound Name | [(3S,3aR,6R,6aR)-6-[(2S)-4-methyl-2-(octanoylamino)pentanoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] (2S)-4-methyl-2-(octanoylamino)pentanoate |
|---|---|
| PubChem CID | 172866623 |
| Molecular Formula | C34H60N2O8 |
| Molecular Weight | 624.86 g/mol |
| Exact Mass | 624.43 |
| IUPAC Name | [(3S,3aR,6R,6aR)-6-[(2S)-4-methyl-2-(octanoylamino)pentanoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] (2S)-4-methyl-2-(octanoylamino)pentanoate |
| SMILES | CCCCCCCC(=O)N[C@@H](CC(C)C)C(=O)O[C@H]1CO[C@H]2[C@@H]1OC[C@H]2OC(=O)[C@H](CC(C)C)NC(=O)CCCCCCC |
| InChI | InChI=1S/C34H60N2O8/c1-7-9-11-13-15-17-29(37)35-25(19-23(3)4)33(39)43-27-21-41-32-28(22-42-31(27)32)44-34(40)26(20-24(5)6)36-30(38)18-16-14-12-10-8-2/h23-28,31-32H,7-22H2,1-6H3,(H,35,37)(H,36,38)/t25-,26-,27-,28+,31+,32+/m0/s1 |
| InChIKey | CHIMNMBYEFKHOO-CZMJDTDDSA-N |
| XLogP | 5.39 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.86 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|