C32H59NO6 — CID 158538535
6-[4-methyl-2-(nonanoylamino)pentanoyl]oxyhexyl 2-(2-methylpropyl)-4-oxoheptanoate (PubChem CID 158538535) has the molecular formula C32H59NO6 and a molecular weight of 553.83 g/mol. Its IUPAC name is 6-[4-methyl-2-(nonanoylamino)pentanoyl]oxyhexyl 2-(2-methylpropyl)-4-oxoheptanoate.
| Compound Name | 6-[4-methyl-2-(nonanoylamino)pentanoyl]oxyhexyl 2-(2-methylpropyl)-4-oxoheptanoate |
|---|---|
| PubChem CID | 158538535 |
| Molecular Formula | C32H59NO6 |
| Molecular Weight | 553.83 g/mol |
| Exact Mass | 553.43 |
| IUPAC Name | 6-[4-methyl-2-(nonanoylamino)pentanoyl]oxyhexyl 2-(2-methylpropyl)-4-oxoheptanoate |
| SMILES | CCCCCCCCC(=O)NC(CC(C)C)C(=O)OCCCCCCOC(=O)C(CC(=O)CCC)CC(C)C |
| InChI | InChI=1S/C32H59NO6/c1-7-9-10-11-12-15-19-30(35)33-29(23-26(5)6)32(37)39-21-17-14-13-16-20-38-31(36)27(22-25(3)4)24-28(34)18-8-2/h25-27,29H,7-24H2,1-6H3,(H,33,35) |
| InChIKey | ZCYZBNPBIVLTFK-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.83 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|