C14H25NO5 — CID 10902255
[(3S,6R)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N,N-di(propan-2-yl)carbamate (PubChem CID 10902255) has the molecular formula C14H25NO5 and a molecular weight of 287.36 g/mol. Its IUPAC name is [(3S,6R)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(3S,6R)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 10902255 |
| Molecular Formula | C14H25NO5 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | [(3S,6R)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N,N-di(propan-2-yl)carbamate |
| SMILES | CO[C@H]1COC2C1OC[C@H]2OC(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C14H25NO5/c1-8(2)15(9(3)4)14(16)20-11-7-19-12-10(17-5)6-18-13(11)12/h8-13H,6-7H2,1-5H3/t10-,11+,12?,13?/m0/s1 |
| InChIKey | JCGYQWAKEDJVBQ-ZFDZMSFRSA-N |
| XLogP | 1.42 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |