C54H104N2O10 — CID 176659205
[6-[4-[bis(2-hydroxydecyl)amino]butanoyloxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-[bis(2-hydroxydecyl)amino]butanoate (PubChem CID 176659205) has the molecular formula C54H104N2O10 and a molecular weight of 941.43 g/mol. Its IUPAC name is [6-[4-[bis(2-hydroxydecyl)amino]butanoyloxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-[bis(2-hydroxydecyl)amino]butanoate.
| Compound Name | [6-[4-[bis(2-hydroxydecyl)amino]butanoyloxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-[bis(2-hydroxydecyl)amino]butanoate |
|---|---|
| PubChem CID | 176659205 |
| Molecular Formula | C54H104N2O10 |
| Molecular Weight | 941.43 g/mol |
| Exact Mass | 940.77 |
| IUPAC Name | [6-[4-[bis(2-hydroxydecyl)amino]butanoyloxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-[bis(2-hydroxydecyl)amino]butanoate |
| SMILES | CCCCCCCCC(O)CN(CCCC(=O)OC1COC2C(OC(=O)CCCN(CC(O)CCCCCCCC)CC(O)CCCCCCCC)COC12)CC(O)CCCCCCCC |
| InChI | InChI=1S/C54H104N2O10/c1-5-9-13-17-21-25-31-45(57)39-55(40-46(58)32-26-22-18-14-10-6-2)37-29-35-51(61)65-49-43-63-54-50(44-64-53(49)54)66-52(62)36-30-38-56(41-47(59)33-27-23-19-15-11-7-3)42-48(60)34-28-24-20-16-12-8-4/h45-50,53-54,57-60H,5-44H2,1-4H3 |
| InChIKey | RWSGASKCFXDBDW-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 158.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 941.43 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|