C23H47NO4 — CID 164829125
3-[bis(2-hydroxydecyl)amino]propanoic acid (PubChem CID 164829125) has the molecular formula C23H47NO4 and a molecular weight of 401.63 g/mol. Its IUPAC name is 3-[bis(2-hydroxydecyl)amino]propanoic acid.
| Compound Name | 3-[bis(2-hydroxydecyl)amino]propanoic acid |
|---|---|
| PubChem CID | 164829125 |
| Molecular Formula | C23H47NO4 |
| Molecular Weight | 401.63 g/mol |
| Exact Mass | 401.35 |
| IUPAC Name | 3-[bis(2-hydroxydecyl)amino]propanoic acid |
| SMILES | CCCCCCCCC(O)CN(CCC(=O)O)CC(O)CCCCCCCC |
| InChI | InChI=1S/C23H47NO4/c1-3-5-7-9-11-13-15-21(25)19-24(18-17-23(27)28)20-22(26)16-14-12-10-8-6-4-2/h21-22,25-26H,3-20H2,1-2H3,(H,27,28) |
| InChIKey | UWCPHNOKYGJKNA-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.63 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|