2-[2,2-dihydroxyethyl(2-hydroxytetradecyl)amino]acetic acid

C18H37NO5 — CID 101465100

IUPAC2-[2,2-dihydroxyethyl(2-hydroxytetradecyl)amino]acetic acid
SMILESCCCCCCCCCCCCC(O)CN(CC(=O)O)CC(O)O
InChIInChI=1S/C18H37NO5/c1-2-3-4-5-6-7-8-9-10-11-12-16(20)13-19(14-17(21)22)15-18(23)24/h16-17,20-22H,2-15H2,1H3,(H,23,24)
InChIKeyDNWPFEQZGDAVHY-UHFFFAOYSA-N
MW347.50 g/mol
LogP2.36
Rot. Bonds17

About 2-[2,2-dihydroxyethyl(2-hydroxytetradecyl)amino]acetic acid

2-[2,2-dihydroxyethyl(2-hydroxytetradecyl)amino]acetic acid (PubChem CID 101465100) has the molecular formula C18H37NO5 and a molecular weight of 347.50 g/mol. Its IUPAC name is 2-[2,2-dihydroxyethyl(2-hydroxytetradecyl)amino]acetic acid.

Molecular Properties

Compound Name2-[2,2-dihydroxyethyl(2-hydroxytetradecyl)amino]acetic acid
PubChem CID101465100
Molecular FormulaC18H37NO5
Molecular Weight347.50 g/mol
Exact Mass347.27
IUPAC Name2-[2,2-dihydroxyethyl(2-hydroxytetradecyl)amino]acetic acid
SMILESCCCCCCCCCCCCC(O)CN(CC(=O)O)CC(O)O
InChIInChI=1S/C18H37NO5/c1-2-3-4-5-6-7-8-9-10-11-12-16(20)13-19(14-17(21)22)15-18(23)24/h16-17,20-22H,2-15H2,1H3,(H,23,24)
InChIKeyDNWPFEQZGDAVHY-UHFFFAOYSA-N
XLogP2.36
TPSA101.23 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds17
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500347.50
LogP ≤ 52.36
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 2-[2,2-dihydroxyethyl(2-hydroxytetradecyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2,2-dihydroxyethyl(2-hydroxytetradecyl)amino]acetic acid?
The IUPAC name of 2-[2,2-dihydroxyethyl(2-hydroxytetradecyl)amino]acetic acid (CID 101465100) is 2-[2,2-dihydroxyethyl(2-hydroxytetradecyl)amino]acetic acid.
What is the SMILES notation for 2-[2,2-dihydroxyethyl(2-hydroxytetradecyl)amino]acetic acid?
The canonical SMILES for 2-[2,2-dihydroxyethyl(2-hydroxytetradecyl)amino]acetic acid is CCCCCCCCCCCCC(O)CN(CC(=O)O)CC(O)O.
What is the InChIKey of 2-[2,2-dihydroxyethyl(2-hydroxytetradecyl)amino]acetic acid?
The InChIKey is DNWPFEQZGDAVHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37NO5/c1-2-3-4-5-6-7-8-9-10-11-12-16(20)13-19(14-17(21)22)15-18(23)24/h16-17,20-22H,2-15H2,1H3,(H,23,24).
What are the key properties of 2-[2,2-dihydroxyethyl(2-hydroxytetradecyl)amino]acetic acid?
2-[2,2-dihydroxyethyl(2-hydroxytetradecyl)amino]acetic acid has a molecular weight of 347.50 g/mol, XLogP of 2.36, 17 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-dihydroxyethyl(2-hydroxytetradecyl)amino]acetic acid is sourced from PubChem (CID 101465100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).