C18H37NO5 — CID 101465100
2-[2,2-dihydroxyethyl(2-hydroxytetradecyl)amino]acetic acid (PubChem CID 101465100) has the molecular formula C18H37NO5 and a molecular weight of 347.50 g/mol. Its IUPAC name is 2-[2,2-dihydroxyethyl(2-hydroxytetradecyl)amino]acetic acid.
| Compound Name | 2-[2,2-dihydroxyethyl(2-hydroxytetradecyl)amino]acetic acid |
|---|---|
| PubChem CID | 101465100 |
| Molecular Formula | C18H37NO5 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.27 |
| IUPAC Name | 2-[2,2-dihydroxyethyl(2-hydroxytetradecyl)amino]acetic acid |
| SMILES | CCCCCCCCCCCCC(O)CN(CC(=O)O)CC(O)O |
| InChI | InChI=1S/C18H37NO5/c1-2-3-4-5-6-7-8-9-10-11-12-16(20)13-19(14-17(21)22)15-18(23)24/h16-17,20-22H,2-15H2,1H3,(H,23,24) |
| InChIKey | DNWPFEQZGDAVHY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|