C19H39NO4 — CID 99119531
3-[2-hydroxyethyl-[(2R)-2-hydroxytetradecyl]amino]propanoic acid (PubChem CID 99119531) has the molecular formula C19H39NO4 and a molecular weight of 345.52 g/mol. Its IUPAC name is 3-[2-hydroxyethyl-[(2R)-2-hydroxytetradecyl]amino]propanoic acid.
| Compound Name | 3-[2-hydroxyethyl-[(2R)-2-hydroxytetradecyl]amino]propanoic acid |
|---|---|
| PubChem CID | 99119531 |
| Molecular Formula | C19H39NO4 |
| Molecular Weight | 345.52 g/mol |
| Exact Mass | 345.29 |
| IUPAC Name | 3-[2-hydroxyethyl-[(2R)-2-hydroxytetradecyl]amino]propanoic acid |
| SMILES | CCCCCCCCCCCC[C@@H](O)CN(CCO)CCC(=O)O |
| InChI | InChI=1S/C19H39NO4/c1-2-3-4-5-6-7-8-9-10-11-12-18(22)17-20(15-16-21)14-13-19(23)24/h18,21-22H,2-17H2,1H3,(H,23,24)/t18-/m1/s1 |
| InChIKey | UNQIFGWGEAIJPF-GOSISDBHSA-N |
| XLogP | 3.43 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|