C14H27NO6 — CID 59875895
4-[3-carboxypropyl(2,6-dihydroxyhexyl)amino]butanoic acid (PubChem CID 59875895) has the molecular formula C14H27NO6 and a molecular weight of 305.37 g/mol. Its IUPAC name is 4-[3-carboxypropyl(2,6-dihydroxyhexyl)amino]butanoic acid.
| Compound Name | 4-[3-carboxypropyl(2,6-dihydroxyhexyl)amino]butanoic acid |
|---|---|
| PubChem CID | 59875895 |
| Molecular Formula | C14H27NO6 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | 4-[3-carboxypropyl(2,6-dihydroxyhexyl)amino]butanoic acid |
| SMILES | O=C(O)CCCN(CCCC(=O)O)CC(O)CCCCO |
| InChI | InChI=1S/C14H27NO6/c16-10-2-1-5-12(17)11-15(8-3-6-13(18)19)9-4-7-14(20)21/h12,16-17H,1-11H2,(H,18,19)(H,20,21) |
| InChIKey | YSQNUEVDYBMWTK-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|