About 8-(diethylamino)octane-1,7-diol
8-(diethylamino)octane-1,7-diol (PubChem CID 19030812) has the molecular formula C12H27NO2
and a molecular weight of 217.35 g/mol. Its IUPAC name is 8-(diethylamino)octane-1,7-diol.
Molecular Properties
| Compound Name | 8-(diethylamino)octane-1,7-diol |
| PubChem CID | 19030812 |
| Molecular Formula | C12H27NO2 |
| Molecular Weight | 217.35 g/mol |
| Exact Mass | 217.20 |
| IUPAC Name | 8-(diethylamino)octane-1,7-diol |
| SMILES | CCN(CC)CC(O)CCCCCCO |
| InChI | InChI=1S/C12H27NO2/c1-3-13(4-2)11-12(15)9-7-5-6-8-10-14/h12,14-15H,3-11H2,1-2H3 |
| InChIKey | RGHNXIINTCBEIW-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-(diethylamino)octane-1,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(diethylamino)octane-1,7-diol?
The IUPAC name of 8-(diethylamino)octane-1,7-diol (CID 19030812) is 8-(diethylamino)octane-1,7-diol.
What is the SMILES notation for 8-(diethylamino)octane-1,7-diol?
The canonical SMILES for 8-(diethylamino)octane-1,7-diol is CCN(CC)CC(O)CCCCCCO.
What is the InChIKey of 8-(diethylamino)octane-1,7-diol?
The InChIKey is RGHNXIINTCBEIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27NO2/c1-3-13(4-2)11-12(15)9-7-5-6-8-10-14/h12,14-15H,3-11H2,1-2H3.
What are the key properties of 8-(diethylamino)octane-1,7-diol?
8-(diethylamino)octane-1,7-diol has a molecular weight of 217.35 g/mol, XLogP of 1.63, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(diethylamino)octane-1,7-diol is sourced from PubChem (CID 19030812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).