C15H27O7S- — CID 163776541
3-[[(3R,6S)-3-hexoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]propane-1-sulfonate (PubChem CID 163776541) has the molecular formula C15H27O7S- and a molecular weight of 351.44 g/mol. Its IUPAC name is 3-[[(3R,6S)-3-hexoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]propane-1-sulfonate.
| Compound Name | 3-[[(3R,6S)-3-hexoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]propane-1-sulfonate |
|---|---|
| PubChem CID | 163776541 |
| Molecular Formula | C15H27O7S- |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 3-[[(3R,6S)-3-hexoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]propane-1-sulfonate |
| SMILES | CCCCCCO[C@@H]1COC2C1OC[C@@H]2OCCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C15H28O7S/c1-2-3-4-5-7-19-12-10-21-15-13(11-22-14(12)15)20-8-6-9-23(16,17)18/h12-15H,2-11H2,1H3,(H,16,17,18)/p-1/t12-,13+,14?,15?/m1/s1 |
| InChIKey | MKYSVYBPIYIRHN-DNDYEEKYSA-M |
| XLogP | 1.07 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|