C8H18O6S — CID 159923464
methanol;(2R,4S,5R)-2-(2-sulfanylethoxy)oxane-3,4,5-triol (PubChem CID 159923464) has the molecular formula C8H18O6S and a molecular weight of 242.29 g/mol. Its IUPAC name is methanol;(2R,4S,5R)-2-(2-sulfanylethoxy)oxane-3,4,5-triol.
| Compound Name | methanol;(2R,4S,5R)-2-(2-sulfanylethoxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 159923464 |
| Molecular Formula | C8H18O6S |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | methanol;(2R,4S,5R)-2-(2-sulfanylethoxy)oxane-3,4,5-triol |
| SMILES | CO.OC1[C@@H](OCCS)OC[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H14O5S.CH4O/c8-4-3-12-7(11-1-2-13)6(10)5(4)9;1-2/h4-10,13H,1-3H2;2H,1H3/t4-,5+,6?,7+;/m1./s1 |
| InChIKey | NYSDKLZIZRZYAI-RXDKOZSFSA-N |
| XLogP | -2.02 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|