C6H13NO4 — CID 142369560
2-(2-aminoethoxy)oxolane-3,4-diol (PubChem CID 142369560) has the molecular formula C6H13NO4 and a molecular weight of 163.17 g/mol. Its IUPAC name is 2-(2-aminoethoxy)oxolane-3,4-diol.
| Compound Name | 2-(2-aminoethoxy)oxolane-3,4-diol |
|---|---|
| PubChem CID | 142369560 |
| Molecular Formula | C6H13NO4 |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | 2-(2-aminoethoxy)oxolane-3,4-diol |
| SMILES | NCCOC1OCC(O)C1O |
| InChI | InChI=1S/C6H13NO4/c7-1-2-10-6-5(9)4(8)3-11-6/h4-6,8-9H,1-3,7H2 |
| InChIKey | NWYVBDWXNHZBKU-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.17 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |