C7H14FNO4 — CID 145030712
2-(2-aminoethoxy)-5-fluorooxane-3,4-diol (PubChem CID 145030712) has the molecular formula C7H14FNO4 and a molecular weight of 195.19 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-5-fluorooxane-3,4-diol.
| Compound Name | 2-(2-aminoethoxy)-5-fluorooxane-3,4-diol |
|---|---|
| PubChem CID | 145030712 |
| Molecular Formula | C7H14FNO4 |
| Molecular Weight | 195.19 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 2-(2-aminoethoxy)-5-fluorooxane-3,4-diol |
| SMILES | NCCOC1OCC(F)C(O)C1O |
| InChI | InChI=1S/C7H14FNO4/c8-4-3-13-7(12-2-1-9)6(11)5(4)10/h4-7,10-11H,1-3,9H2 |
| InChIKey | HKAWXGIJWYWRSC-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.19 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |