C8H19NO5 — CID 142369559
2-(2-aminoethoxy)oxolane-3,4-diol;ethanol (PubChem CID 142369559) has the molecular formula C8H19NO5 and a molecular weight of 209.24 g/mol. Its IUPAC name is 2-(2-aminoethoxy)oxolane-3,4-diol;ethanol.
| Compound Name | 2-(2-aminoethoxy)oxolane-3,4-diol;ethanol |
|---|---|
| PubChem CID | 142369559 |
| Molecular Formula | C8H19NO5 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 2-(2-aminoethoxy)oxolane-3,4-diol;ethanol |
| SMILES | CCO.NCCOC1OCC(O)C1O |
| InChI | InChI=1S/C6H13NO4.C2H6O/c7-1-2-10-6-5(9)4(8)3-11-6;1-2-3/h4-6,8-9H,1-3,7H2;3H,2H2,1H3 |
| InChIKey | KWMIGTKRMCGVRV-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |