C16H24N2O6S — CID 175302142
2-methoxy-4-prop-2-enylphenol;[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]thiourea (PubChem CID 175302142) has the molecular formula C16H24N2O6S and a molecular weight of 372.44 g/mol. Its IUPAC name is 2-methoxy-4-prop-2-enylphenol;[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]thiourea.
| Compound Name | 2-methoxy-4-prop-2-enylphenol;[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]thiourea |
|---|---|
| PubChem CID | 175302142 |
| Molecular Formula | C16H24N2O6S |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 2-methoxy-4-prop-2-enylphenol;[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]thiourea |
| SMILES | C=CCc1ccc(O)c(OC)c1.NC(=S)NC1OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H12O2.C6H12N2O4S/c1-3-4-8-5-6-9(11)10(7-8)12-2;7-6(13)8-5-4(11)3(10)2(9)1-12-5/h3,5-7,11H,1,4H2,2H3;2-5,9-11H,1H2,(H3,7,8,13)/t;2-,3+,4-,5?/m.1/s1 |
| InChIKey | KWWWIRMDZNHGOR-HWQQROTDSA-N |
| XLogP | -0.61 |
| TPSA | 137.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|