C14H16N2O6S — CID 3482863
4-[(3-acetyloxy-1,4-dioxan-2-yl)carbamothioylamino]benzoic acid (PubChem CID 3482863) has the molecular formula C14H16N2O6S and a molecular weight of 340.36 g/mol. Its IUPAC name is 4-[(3-acetyloxy-1,4-dioxan-2-yl)carbamothioylamino]benzoic acid.
| Compound Name | 4-[(3-acetyloxy-1,4-dioxan-2-yl)carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 3482863 |
| Molecular Formula | C14H16N2O6S |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 4-[(3-acetyloxy-1,4-dioxan-2-yl)carbamothioylamino]benzoic acid |
| SMILES | CC(=O)OC1OCCOC1NC(=S)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C14H16N2O6S/c1-8(17)22-13-11(20-6-7-21-13)16-14(23)15-10-4-2-9(3-5-10)12(18)19/h2-5,11,13H,6-7H2,1H3,(H,18,19)(H2,15,16,23) |
| InChIKey | AJMLJXDISIHTAR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|