C22H25N3O5 — CID 22711569
[3-[[4-(4-anilinoanilino)-4-oxobutanoyl]amino]oxolan-2-yl] acetate (PubChem CID 22711569) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is [3-[[4-(4-anilinoanilino)-4-oxobutanoyl]amino]oxolan-2-yl] acetate.
| Compound Name | [3-[[4-(4-anilinoanilino)-4-oxobutanoyl]amino]oxolan-2-yl] acetate |
|---|---|
| PubChem CID | 22711569 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | [3-[[4-(4-anilinoanilino)-4-oxobutanoyl]amino]oxolan-2-yl] acetate |
| SMILES | CC(=O)OC1OCCC1NC(=O)CCC(=O)Nc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C22H25N3O5/c1-15(26)30-22-19(13-14-29-22)25-21(28)12-11-20(27)24-18-9-7-17(8-10-18)23-16-5-3-2-4-6-16/h2-10,19,22-23H,11-14H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | INVJFBNWEMWCRR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |