C14H18N2O4S — CID 759175
[(2R,3S)-3-[(4-methylphenyl)carbamothioylamino]-1,4-dioxan-2-yl] acetate (PubChem CID 759175) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is [(2R,3S)-3-[(4-methylphenyl)carbamothioylamino]-1,4-dioxan-2-yl] acetate.
| Compound Name | [(2R,3S)-3-[(4-methylphenyl)carbamothioylamino]-1,4-dioxan-2-yl] acetate |
|---|---|
| PubChem CID | 759175 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | [(2R,3S)-3-[(4-methylphenyl)carbamothioylamino]-1,4-dioxan-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1OCCO[C@@H]1NC(=S)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C14H18N2O4S/c1-9-3-5-11(6-4-9)15-14(21)16-12-13(20-10(2)17)19-8-7-18-12/h3-6,12-13H,7-8H2,1-2H3,(H2,15,16,21)/t12-,13+/m0/s1 |
| InChIKey | LDUGLUSMNLSPLG-QWHCGFSZSA-N |
| XLogP | 1.54 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|