C27H34N4O9S — CID 22696266
[(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[4-cyclopropyl-3-[(3-methylphenoxy)methyl]-5-sulfanylidene-1,2,4-triazol-1-yl]oxan-2-yl]methyl acetate (PubChem CID 22696266) has the molecular formula C27H34N4O9S and a molecular weight of 590.66 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[4-cyclopropyl-3-[(3-methylphenoxy)methyl]-5-sulfanylidene-1,2,4-triazol-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[4-cyclopropyl-3-[(3-methylphenoxy)methyl]-5-sulfanylidene-1,2,4-triazol-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 22696266 |
| Molecular Formula | C27H34N4O9S |
| Molecular Weight | 590.66 g/mol |
| Exact Mass | 590.20 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[4-cyclopropyl-3-[(3-methylphenoxy)methyl]-5-sulfanylidene-1,2,4-triazol-1-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O[C@H]1n1nc(COc2cccc(C)c2)n(C2CC2)c1=S |
| InChI | InChI=1S/C27H34N4O9S/c1-14-7-6-8-20(11-14)37-13-22-29-31(27(41)30(22)19-9-10-19)26-23(28-15(2)32)25(39-18(5)35)24(38-17(4)34)21(40-26)12-36-16(3)33/h6-8,11,19,21,23-26H,9-10,12-13H2,1-5H3,(H,28,32)/t21-,23-,24-,25-,26-/m1/s1 |
| InChIKey | FOKCCGPLQJTJTP-SMHDKVMMSA-N |
| XLogP | 2.47 |
| TPSA | 149.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.66 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|