C26H32N4O8S — CID 22696101
[(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[3-(4-methylphenyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]oxan-2-yl]methyl acetate (PubChem CID 22696101) has the molecular formula C26H32N4O8S and a molecular weight of 560.63 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[3-(4-methylphenyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[3-(4-methylphenyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 22696101 |
| Molecular Formula | C26H32N4O8S |
| Molecular Weight | 560.63 g/mol |
| Exact Mass | 560.19 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[3-(4-methylphenyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]oxan-2-yl]methyl acetate |
| SMILES | C=CCn1c(-c2ccc(C)cc2)nn([C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2NC(C)=O)c1=S |
| InChI | InChI=1S/C26H32N4O8S/c1-7-12-29-24(19-10-8-14(2)9-11-19)28-30(26(29)39)25-21(27-15(3)31)23(37-18(6)34)22(36-17(5)33)20(38-25)13-35-16(4)32/h7-11,20-23,25H,1,12-13H2,2-6H3,(H,27,31)/t20-,21-,22-,23-,25-/m1/s1 |
| InChIKey | AUZOJSMESXHGTG-BBPVLXATSA-N |
| XLogP | 2.40 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.63 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|