C22H27NO9Se — CID 102320656
[(2R,3S,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-(4-methylbenzoyl)selanyloxan-2-yl]methyl acetate (PubChem CID 102320656) has the molecular formula C22H27NO9Se and a molecular weight of 528.42 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-(4-methylbenzoyl)selanyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-(4-methylbenzoyl)selanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102320656 |
| Molecular Formula | C22H27NO9Se |
| Molecular Weight | 528.42 g/mol |
| Exact Mass | 529.09 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-(4-methylbenzoyl)selanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O[C@H]1[Se]C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H27NO9Se/c1-11-6-8-16(9-7-11)21(28)33-22-18(23-12(2)24)20(31-15(5)27)19(30-14(4)26)17(32-22)10-29-13(3)25/h6-9,17-20,22H,10H2,1-5H3,(H,23,24)/t17-,18-,19-,20-,22+/m1/s1 |
| InChIKey | ZZENNFQDIZYLTF-DOSYZEEDSA-N |
| XLogP | 0.50 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.42 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|