C20H25N5O9S — CID 10601808
[9-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]purin-6-yl]sulfanylmethyl (2S)-2-aminopropanoate (PubChem CID 10601808) has the molecular formula C20H25N5O9S and a molecular weight of 511.51 g/mol. Its IUPAC name is [9-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]purin-6-yl]sulfanylmethyl (2S)-2-aminopropanoate.
| Compound Name | [9-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]purin-6-yl]sulfanylmethyl (2S)-2-aminopropanoate |
|---|---|
| PubChem CID | 10601808 |
| Molecular Formula | C20H25N5O9S |
| Molecular Weight | 511.51 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | [9-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]purin-6-yl]sulfanylmethyl (2S)-2-aminopropanoate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cnc3c(SCOC(=O)[C@H](C)N)ncnc32)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H25N5O9S/c1-9(21)20(29)31-8-35-18-14-17(22-6-23-18)25(7-24-14)19-16(33-12(4)28)15(32-11(3)27)13(34-19)5-30-10(2)26/h6-7,9,13,15-16,19H,5,8,21H2,1-4H3/t9-,13+,15+,16+,19+/m0/s1 |
| InChIKey | TZOOPWJYEDMJII-CNVJSINISA-N |
| XLogP | 0.09 |
| TPSA | 184.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.51 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|