C25H33N5O11S — CID 10746312
[9-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]purin-6-yl]sulfanylmethyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 10746312) has the molecular formula C25H33N5O11S and a molecular weight of 611.63 g/mol. Its IUPAC name is [9-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]purin-6-yl]sulfanylmethyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | [9-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]purin-6-yl]sulfanylmethyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 10746312 |
| Molecular Formula | C25H33N5O11S |
| Molecular Weight | 611.63 g/mol |
| Exact Mass | 611.19 |
| IUPAC Name | [9-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]purin-6-yl]sulfanylmethyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cnc3c(SCOC(=O)CCNC(=O)OC(C)(C)C)ncnc32)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C25H33N5O11S/c1-13(31)36-9-16-19(38-14(2)32)20(39-15(3)33)23(40-16)30-11-29-18-21(30)27-10-28-22(18)42-12-37-17(34)7-8-26-24(35)41-25(4,5)6/h10-11,16,19-20,23H,7-9,12H2,1-6H3,(H,26,35)/t16-,19-,20-,23-/m1/s1 |
| InChIKey | BOTJNCKUSLYSKF-UGTJMOTHSA-N |
| XLogP | 1.66 |
| TPSA | 196.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.63 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|